C21H28N3S2+ — CID 7389624
1-(4-ethylphenyl)-3-[(1R,5S)-8-(thiophen-2-ylmethyl)-8-azoniabicyclo[3.2.1]octan-3-yl]thiourea (PubChem CID 7389624) has the molecular formula C21H28N3S2+ and a molecular weight of 386.61 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[(1R,5S)-8-(thiophen-2-ylmethyl)-8-azoniabicyclo[3.2.1]octan-3-yl]thiourea.
| Compound Name | 1-(4-ethylphenyl)-3-[(1R,5S)-8-(thiophen-2-ylmethyl)-8-azoniabicyclo[3.2.1]octan-3-yl]thiourea |
|---|---|
| PubChem CID | 7389624 |
| Molecular Formula | C21H28N3S2+ |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[(1R,5S)-8-(thiophen-2-ylmethyl)-8-azoniabicyclo[3.2.1]octan-3-yl]thiourea |
| SMILES | CCc1ccc(NC(=S)NC2C[C@H]3CC[C@@H](C2)[NH+]3Cc2cccs2)cc1 |
| InChI | InChI=1S/C21H27N3S2/c1-2-15-5-7-16(8-6-15)22-21(25)23-17-12-18-9-10-19(13-17)24(18)14-20-4-3-11-26-20/h3-8,11,17-19H,2,9-10,12-14H2,1H3,(H2,22,23,25)/p+1/t17?,18-,19+ |
| InChIKey | LEJLHDYKOAYUDU-YQQQUEKLSA-O |
| XLogP | 3.38 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|