C20H31N3S — CID 1461410
1-(4-ethylphenyl)-3-[(1R,5R)-9-propyl-9-azabicyclo[3.3.1]nonan-3-yl]thiourea (PubChem CID 1461410) has the molecular formula C20H31N3S and a molecular weight of 345.56 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[(1R,5R)-9-propyl-9-azabicyclo[3.3.1]nonan-3-yl]thiourea.
| Compound Name | 1-(4-ethylphenyl)-3-[(1R,5R)-9-propyl-9-azabicyclo[3.3.1]nonan-3-yl]thiourea |
|---|---|
| PubChem CID | 1461410 |
| Molecular Formula | C20H31N3S |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[(1R,5R)-9-propyl-9-azabicyclo[3.3.1]nonan-3-yl]thiourea |
| SMILES | CCCN1[C@@H]2CCC[C@@H]1CC(NC(=S)Nc1ccc(CC)cc1)C2 |
| InChI | InChI=1S/C20H31N3S/c1-3-12-23-18-6-5-7-19(23)14-17(13-18)22-20(24)21-16-10-8-15(4-2)9-11-16/h8-11,17-19H,3-7,12-14H2,1-2H3,(H2,21,22,24)/t18-,19-/m1/s1 |
| InChIKey | PBPZLSSNOGQANV-RTBURBONSA-N |
| XLogP | 4.33 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|