C16H31N3S — CID 1461392
1-(2-methylpropyl)-3-[(1R,5R)-9-propyl-9-azabicyclo[3.3.1]nonan-3-yl]thiourea (PubChem CID 1461392) has the molecular formula C16H31N3S and a molecular weight of 297.51 g/mol. Its IUPAC name is 1-(2-methylpropyl)-3-[(1R,5R)-9-propyl-9-azabicyclo[3.3.1]nonan-3-yl]thiourea.
| Compound Name | 1-(2-methylpropyl)-3-[(1R,5R)-9-propyl-9-azabicyclo[3.3.1]nonan-3-yl]thiourea |
|---|---|
| PubChem CID | 1461392 |
| Molecular Formula | C16H31N3S |
| Molecular Weight | 297.51 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 1-(2-methylpropyl)-3-[(1R,5R)-9-propyl-9-azabicyclo[3.3.1]nonan-3-yl]thiourea |
| SMILES | CCCN1[C@@H]2CCC[C@@H]1CC(NC(=S)NCC(C)C)C2 |
| InChI | InChI=1S/C16H31N3S/c1-4-8-19-14-6-5-7-15(19)10-13(9-14)18-16(20)17-11-12(2)3/h12-15H,4-11H2,1-3H3,(H2,17,18,20)/t14-,15-/m1/s1 |
| InChIKey | XBANPIMSGWRGCQ-HUUCEWRRSA-N |
| XLogP | 2.90 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|