C20H32ClN3S — CID 175654352
1-(2-ethylphenyl)-3-(9-propyl-9-azabicyclo[3.3.1]nonan-3-yl)thiourea;hydrochloride (PubChem CID 175654352) has the molecular formula C20H32ClN3S and a molecular weight of 382.02 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-3-(9-propyl-9-azabicyclo[3.3.1]nonan-3-yl)thiourea;hydrochloride.
| Compound Name | 1-(2-ethylphenyl)-3-(9-propyl-9-azabicyclo[3.3.1]nonan-3-yl)thiourea;hydrochloride |
|---|---|
| PubChem CID | 175654352 |
| Molecular Formula | C20H32ClN3S |
| Molecular Weight | 382.02 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 1-(2-ethylphenyl)-3-(9-propyl-9-azabicyclo[3.3.1]nonan-3-yl)thiourea;hydrochloride |
| SMILES | CCCN1C2CCCC1CC(NC(=S)Nc1ccccc1CC)C2.Cl |
| InChI | InChI=1S/C20H31N3S.ClH/c1-3-12-23-17-9-7-10-18(23)14-16(13-17)21-20(24)22-19-11-6-5-8-15(19)4-2;/h5-6,8,11,16-18H,3-4,7,9-10,12-14H2,1-2H3,(H2,21,22,24);1H |
| InChIKey | GEISGIQVFHEIIA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.02 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|