C20H28N2O — CID 7403091
(E)-3-phenyl-N-[(1S,5S)-9-propyl-9-azabicyclo[3.3.1]nonan-3-yl]prop-2-enamide (PubChem CID 7403091) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is (E)-3-phenyl-N-[(1S,5S)-9-propyl-9-azabicyclo[3.3.1]nonan-3-yl]prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-[(1S,5S)-9-propyl-9-azabicyclo[3.3.1]nonan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 7403091 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | (E)-3-phenyl-N-[(1S,5S)-9-propyl-9-azabicyclo[3.3.1]nonan-3-yl]prop-2-enamide |
| SMILES | CCCN1[C@H]2CCC[C@H]1CC(NC(=O)/C=C/c1ccccc1)C2 |
| InChI | InChI=1S/C20H28N2O/c1-2-13-22-18-9-6-10-19(22)15-17(14-18)21-20(23)12-11-16-7-4-3-5-8-16/h3-5,7-8,11-12,17-19H,2,6,9-10,13-15H2,1H3,(H,21,23)/b12-11+/t18-,19-/m0/s1 |
| InChIKey | FSKCEIFLUVCKHY-JUFISIKESA-N |
| XLogP | 3.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|