C22H33N3OS — CID 11901106
N-[(1S,5R)-9-[(2-ethylphenyl)carbamothioyl]-9-azabicyclo[3.3.1]nonan-3-yl]-2,2-dimethylpropanamide (PubChem CID 11901106) has the molecular formula C22H33N3OS and a molecular weight of 387.59 g/mol. Its IUPAC name is N-[(1S,5R)-9-[(2-ethylphenyl)carbamothioyl]-9-azabicyclo[3.3.1]nonan-3-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(1S,5R)-9-[(2-ethylphenyl)carbamothioyl]-9-azabicyclo[3.3.1]nonan-3-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 11901106 |
| Molecular Formula | C22H33N3OS |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | N-[(1S,5R)-9-[(2-ethylphenyl)carbamothioyl]-9-azabicyclo[3.3.1]nonan-3-yl]-2,2-dimethylpropanamide |
| SMILES | CCc1ccccc1NC(=S)N1[C@@H]2CCC[C@H]1CC(NC(=O)C(C)(C)C)C2 |
| InChI | InChI=1S/C22H33N3OS/c1-5-15-9-6-7-12-19(15)24-21(27)25-17-10-8-11-18(25)14-16(13-17)23-20(26)22(2,3)4/h6-7,9,12,16-18H,5,8,10-11,13-14H2,1-4H3,(H,23,26)(H,24,27)/t16?,17-,18+ |
| InChIKey | ICNGHSWSEXFDOE-AYHJJNSGSA-N |
| XLogP | 4.49 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|