C18H25N3O2S — CID 50937875
N-[(1S,5S)-9-[(4-methoxyphenyl)carbamothioyl]-9-azabicyclo[3.3.1]nonan-3-yl]acetamide (PubChem CID 50937875) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is N-[(1S,5S)-9-[(4-methoxyphenyl)carbamothioyl]-9-azabicyclo[3.3.1]nonan-3-yl]acetamide.
| Compound Name | N-[(1S,5S)-9-[(4-methoxyphenyl)carbamothioyl]-9-azabicyclo[3.3.1]nonan-3-yl]acetamide |
|---|---|
| PubChem CID | 50937875 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-[(1S,5S)-9-[(4-methoxyphenyl)carbamothioyl]-9-azabicyclo[3.3.1]nonan-3-yl]acetamide |
| SMILES | COc1ccc(NC(=S)N2[C@H]3CCC[C@H]2CC(NC(C)=O)C3)cc1 |
| InChI | InChI=1S/C18H25N3O2S/c1-12(22)19-14-10-15-4-3-5-16(11-14)21(15)18(24)20-13-6-8-17(23-2)9-7-13/h6-9,14-16H,3-5,10-11H2,1-2H3,(H,19,22)(H,20,24)/t15-,16-/m0/s1 |
| InChIKey | YARZRAKFMNIXAG-HOTGVXAUSA-N |
| XLogP | 2.91 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|