C23H27N3OS — CID 7389862
3-methyl-N-[(1R,5S)-9-(phenylcarbamothioyl)-9-azabicyclo[3.3.1]nonan-3-yl]benzamide (PubChem CID 7389862) has the molecular formula C23H27N3OS and a molecular weight of 393.56 g/mol. Its IUPAC name is 3-methyl-N-[(1R,5S)-9-(phenylcarbamothioyl)-9-azabicyclo[3.3.1]nonan-3-yl]benzamide.
| Compound Name | 3-methyl-N-[(1R,5S)-9-(phenylcarbamothioyl)-9-azabicyclo[3.3.1]nonan-3-yl]benzamide |
|---|---|
| PubChem CID | 7389862 |
| Molecular Formula | C23H27N3OS |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 3-methyl-N-[(1R,5S)-9-(phenylcarbamothioyl)-9-azabicyclo[3.3.1]nonan-3-yl]benzamide |
| SMILES | Cc1cccc(C(=O)NC2C[C@H]3CCC[C@@H](C2)N3C(=S)Nc2ccccc2)c1 |
| InChI | InChI=1S/C23H27N3OS/c1-16-7-5-8-17(13-16)22(27)24-19-14-20-11-6-12-21(15-19)26(20)23(28)25-18-9-3-2-4-10-18/h2-5,7-10,13,19-21H,6,11-12,14-15H2,1H3,(H,24,27)(H,25,28)/t19?,20-,21+ |
| InChIKey | FDDNAGXVMWNGHX-SEJPIABJSA-N |
| XLogP | 4.51 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|