C17H22FN3OS — CID 11902418
3-fluoro-N-[(1S,5R)-9-(methylcarbamothioyl)-9-azabicyclo[3.3.1]nonan-3-yl]benzamide (PubChem CID 11902418) has the molecular formula C17H22FN3OS and a molecular weight of 335.45 g/mol. Its IUPAC name is 3-fluoro-N-[(1S,5R)-9-(methylcarbamothioyl)-9-azabicyclo[3.3.1]nonan-3-yl]benzamide.
| Compound Name | 3-fluoro-N-[(1S,5R)-9-(methylcarbamothioyl)-9-azabicyclo[3.3.1]nonan-3-yl]benzamide |
|---|---|
| PubChem CID | 11902418 |
| Molecular Formula | C17H22FN3OS |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 3-fluoro-N-[(1S,5R)-9-(methylcarbamothioyl)-9-azabicyclo[3.3.1]nonan-3-yl]benzamide |
| SMILES | CNC(=S)N1[C@@H]2CCC[C@H]1CC(NC(=O)c1cccc(F)c1)C2 |
| InChI | InChI=1S/C17H22FN3OS/c1-19-17(23)21-14-6-3-7-15(21)10-13(9-14)20-16(22)11-4-2-5-12(18)8-11/h2,4-5,8,13-15H,3,6-7,9-10H2,1H3,(H,19,23)(H,20,22)/t13?,14-,15+ |
| InChIKey | PZBGEKSLXFTGRG-GOOCMWNKSA-N |
| XLogP | 2.45 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|