C14H19NO — CID 897142
N-(2-ethylphenyl)cyclopentanecarboxamide (PubChem CID 897142) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is N-(2-ethylphenyl)cyclopentanecarboxamide.
| Compound Name | N-(2-ethylphenyl)cyclopentanecarboxamide |
|---|---|
| PubChem CID | 897142 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | N-(2-ethylphenyl)cyclopentanecarboxamide |
| SMILES | CCc1ccccc1NC(=O)C1CCCC1 |
| InChI | InChI=1S/C14H19NO/c1-2-11-7-5-6-10-13(11)15-14(16)12-8-3-4-9-12/h5-7,10,12H,2-4,8-9H2,1H3,(H,15,16) |
| InChIKey | ZZGQAJWPXAVLQV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |