C22H34N2O2 — CID 109150141
1-N-(2-ethylphenyl)-4-N,4-N-dipropylcyclohexane-1,4-dicarboxamide (PubChem CID 109150141) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 1-N-(2-ethylphenyl)-4-N,4-N-dipropylcyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N-(2-ethylphenyl)-4-N,4-N-dipropylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109150141 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | 1-N-(2-ethylphenyl)-4-N,4-N-dipropylcyclohexane-1,4-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1CCC(C(=O)Nc2ccccc2CC)CC1 |
| InChI | InChI=1S/C22H34N2O2/c1-4-15-24(16-5-2)22(26)19-13-11-18(12-14-19)21(25)23-20-10-8-7-9-17(20)6-3/h7-10,18-19H,4-6,11-16H2,1-3H3,(H,23,25) |
| InChIKey | MVYHDBTWDLWHIU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |