C20H28N2O4 — CID 109149471
methyl 2-[[4-(diethylcarbamoyl)cyclohexanecarbonyl]amino]benzoate (PubChem CID 109149471) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is methyl 2-[[4-(diethylcarbamoyl)cyclohexanecarbonyl]amino]benzoate.
| Compound Name | methyl 2-[[4-(diethylcarbamoyl)cyclohexanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109149471 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | methyl 2-[[4-(diethylcarbamoyl)cyclohexanecarbonyl]amino]benzoate |
| SMILES | CCN(CC)C(=O)C1CCC(C(=O)Nc2ccccc2C(=O)OC)CC1 |
| InChI | InChI=1S/C20H28N2O4/c1-4-22(5-2)19(24)15-12-10-14(11-13-15)18(23)21-17-9-7-6-8-16(17)20(25)26-3/h6-9,14-15H,4-5,10-13H2,1-3H3,(H,21,23) |
| InChIKey | NSSBXKLUNLLBDR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |