C22H32N2O4 — CID 109149984
ethyl 2-[[4-[butyl(methyl)carbamoyl]cyclohexanecarbonyl]amino]benzoate (PubChem CID 109149984) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is ethyl 2-[[4-[butyl(methyl)carbamoyl]cyclohexanecarbonyl]amino]benzoate.
| Compound Name | ethyl 2-[[4-[butyl(methyl)carbamoyl]cyclohexanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109149984 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | ethyl 2-[[4-[butyl(methyl)carbamoyl]cyclohexanecarbonyl]amino]benzoate |
| SMILES | CCCCN(C)C(=O)C1CCC(C(=O)Nc2ccccc2C(=O)OCC)CC1 |
| InChI | InChI=1S/C22H32N2O4/c1-4-6-15-24(3)21(26)17-13-11-16(12-14-17)20(25)23-19-10-8-7-9-18(19)22(27)28-5-2/h7-10,16-17H,4-6,11-15H2,1-3H3,(H,23,25) |
| InChIKey | ZMFKYRAFUYQXSE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |