C22H33N3O2 — CID 109147541
N-(2-ethylphenyl)-4-(4-ethylpiperazine-1-carbonyl)cyclohexane-1-carboxamide (PubChem CID 109147541) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-(2-ethylphenyl)-4-(4-ethylpiperazine-1-carbonyl)cyclohexane-1-carboxamide.
| Compound Name | N-(2-ethylphenyl)-4-(4-ethylpiperazine-1-carbonyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 109147541 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N-(2-ethylphenyl)-4-(4-ethylpiperazine-1-carbonyl)cyclohexane-1-carboxamide |
| SMILES | CCc1ccccc1NC(=O)C1CCC(C(=O)N2CCN(CC)CC2)CC1 |
| InChI | InChI=1S/C22H33N3O2/c1-3-17-7-5-6-8-20(17)23-21(26)18-9-11-19(12-10-18)22(27)25-15-13-24(4-2)14-16-25/h5-8,18-19H,3-4,9-16H2,1-2H3,(H,23,26) |
| InChIKey | ZTQVHGNATXVWSJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |