C19H28N2O2 — CID 109140512
2-N-(2-ethylphenyl)-1-N,1-N-dipropylcyclopropane-1,2-dicarboxamide (PubChem CID 109140512) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is 2-N-(2-ethylphenyl)-1-N,1-N-dipropylcyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-(2-ethylphenyl)-1-N,1-N-dipropylcyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109140512 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 2-N-(2-ethylphenyl)-1-N,1-N-dipropylcyclopropane-1,2-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1CC1C(=O)Nc1ccccc1CC |
| InChI | InChI=1S/C19H28N2O2/c1-4-11-21(12-5-2)19(23)16-13-15(16)18(22)20-17-10-8-7-9-14(17)6-3/h7-10,15-16H,4-6,11-13H2,1-3H3,(H,20,22) |
| InChIKey | QRSAAAGUCCZDMR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |