C21H26N2O2 — CID 108968190
N,N'-bis(2-ethylphenyl)-2,2-dimethylpropanediamide (PubChem CID 108968190) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N,N'-bis(2-ethylphenyl)-2,2-dimethylpropanediamide.
| Compound Name | N,N'-bis(2-ethylphenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108968190 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N,N'-bis(2-ethylphenyl)-2,2-dimethylpropanediamide |
| SMILES | CCc1ccccc1NC(=O)C(C)(C)C(=O)Nc1ccccc1CC |
| InChI | InChI=1S/C21H26N2O2/c1-5-15-11-7-9-13-17(15)22-19(24)21(3,4)20(25)23-18-14-10-8-12-16(18)6-2/h7-14H,5-6H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | RUNYULXBXCIEPT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|