C22H28N2O3 — CID 108964450
N-(2-ethylphenyl)-N'-[2-(4-methoxyphenyl)ethyl]-2,2-dimethylpropanediamide (PubChem CID 108964450) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-(2-ethylphenyl)-N'-[2-(4-methoxyphenyl)ethyl]-2,2-dimethylpropanediamide.
| Compound Name | N-(2-ethylphenyl)-N'-[2-(4-methoxyphenyl)ethyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108964450 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | N-(2-ethylphenyl)-N'-[2-(4-methoxyphenyl)ethyl]-2,2-dimethylpropanediamide |
| SMILES | CCc1ccccc1NC(=O)C(C)(C)C(=O)NCCc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H28N2O3/c1-5-17-8-6-7-9-19(17)24-21(26)22(2,3)20(25)23-15-14-16-10-12-18(27-4)13-11-16/h6-13H,5,14-15H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | ZBYHNDWRNHQTQV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|