C20H23ClN2O2 — CID 108962819
N-[(4-chlorophenyl)methyl]-N'-(2-ethylphenyl)-2,2-dimethylpropanediamide (PubChem CID 108962819) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N'-(2-ethylphenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-N'-(2-ethylphenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108962819 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N'-(2-ethylphenyl)-2,2-dimethylpropanediamide |
| SMILES | CCc1ccccc1NC(=O)C(C)(C)C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H23ClN2O2/c1-4-15-7-5-6-8-17(15)23-19(25)20(2,3)18(24)22-13-14-9-11-16(21)12-10-14/h5-12H,4,13H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | YOYBGNFXMQAZFE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|