C19H18F4N2O2 — CID 108962615
N-[(4-fluorophenyl)methyl]-2,2-dimethyl-N'-[2-(trifluoromethyl)phenyl]propanediamide (PubChem CID 108962615) has the molecular formula C19H18F4N2O2 and a molecular weight of 382.36 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2,2-dimethyl-N'-[2-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2,2-dimethyl-N'-[2-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 108962615 |
| Molecular Formula | C19H18F4N2O2 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2,2-dimethyl-N'-[2-(trifluoromethyl)phenyl]propanediamide |
| SMILES | CC(C)(C(=O)NCc1ccc(F)cc1)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H18F4N2O2/c1-18(2,16(26)24-11-12-7-9-13(20)10-8-12)17(27)25-15-6-4-3-5-14(15)19(21,22)23/h3-10H,11H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | UAUMFJZHUCEGCC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|