C19H18FN3O2 — CID 108962648
N-(2-cyanophenyl)-N'-[(4-fluorophenyl)methyl]-2,2-dimethylpropanediamide (PubChem CID 108962648) has the molecular formula C19H18FN3O2 and a molecular weight of 339.37 g/mol. Its IUPAC name is N-(2-cyanophenyl)-N'-[(4-fluorophenyl)methyl]-2,2-dimethylpropanediamide.
| Compound Name | N-(2-cyanophenyl)-N'-[(4-fluorophenyl)methyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108962648 |
| Molecular Formula | C19H18FN3O2 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | N-(2-cyanophenyl)-N'-[(4-fluorophenyl)methyl]-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)NCc1ccc(F)cc1)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C19H18FN3O2/c1-19(2,17(24)22-12-13-7-9-15(20)10-8-13)18(25)23-16-6-4-3-5-14(16)11-21/h3-10H,12H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | BVJHXJXTMDXXLZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|