C16H21N3O3 — CID 108959798
N-(2-cyanophenyl)-N'-(3-methoxypropyl)-2,2-dimethylpropanediamide (PubChem CID 108959798) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-(2-cyanophenyl)-N'-(3-methoxypropyl)-2,2-dimethylpropanediamide.
| Compound Name | N-(2-cyanophenyl)-N'-(3-methoxypropyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108959798 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-(2-cyanophenyl)-N'-(3-methoxypropyl)-2,2-dimethylpropanediamide |
| SMILES | COCCCNC(=O)C(C)(C)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C16H21N3O3/c1-16(2,14(20)18-9-6-10-22-3)15(21)19-13-8-5-4-7-12(13)11-17/h4-5,7-8H,6,9-10H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | OPJOBNWHBUYJRU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|