C17H24N2O4 — CID 108959753
N-(4-acetylphenyl)-N'-(3-methoxypropyl)-2,2-dimethylpropanediamide (PubChem CID 108959753) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N'-(3-methoxypropyl)-2,2-dimethylpropanediamide.
| Compound Name | N-(4-acetylphenyl)-N'-(3-methoxypropyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108959753 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-(4-acetylphenyl)-N'-(3-methoxypropyl)-2,2-dimethylpropanediamide |
| SMILES | COCCCNC(=O)C(C)(C)C(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C17H24N2O4/c1-12(20)13-6-8-14(9-7-13)19-16(22)17(2,3)15(21)18-10-5-11-23-4/h6-9H,5,10-11H2,1-4H3,(H,18,21)(H,19,22) |
| InChIKey | LFNOUICBWHDBGY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|