C22H26N2O4 — CID 108964399
N-(4-acetylphenyl)-N'-[2-(3-methoxyphenyl)ethyl]-2,2-dimethylpropanediamide (PubChem CID 108964399) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N'-[2-(3-methoxyphenyl)ethyl]-2,2-dimethylpropanediamide.
| Compound Name | N-(4-acetylphenyl)-N'-[2-(3-methoxyphenyl)ethyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108964399 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N-(4-acetylphenyl)-N'-[2-(3-methoxyphenyl)ethyl]-2,2-dimethylpropanediamide |
| SMILES | COc1cccc(CCNC(=O)C(C)(C)C(=O)Nc2ccc(C(C)=O)cc2)c1 |
| InChI | InChI=1S/C22H26N2O4/c1-15(25)17-8-10-18(11-9-17)24-21(27)22(2,3)20(26)23-13-12-16-6-5-7-19(14-16)28-4/h5-11,14H,12-13H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | AFUJBFKLGULWQO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|