C21H28N2O3 — CID 108959402
N-(4-acetylphenyl)-N'-[2-(cyclohexen-1-yl)ethyl]-2,2-dimethylpropanediamide (PubChem CID 108959402) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N'-[2-(cyclohexen-1-yl)ethyl]-2,2-dimethylpropanediamide.
| Compound Name | N-(4-acetylphenyl)-N'-[2-(cyclohexen-1-yl)ethyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108959402 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | N-(4-acetylphenyl)-N'-[2-(cyclohexen-1-yl)ethyl]-2,2-dimethylpropanediamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(C)(C)C(=O)NCCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C21H28N2O3/c1-15(24)17-9-11-18(12-10-17)23-20(26)21(2,3)19(25)22-14-13-16-7-5-4-6-8-16/h7,9-12H,4-6,8,13-14H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | QGCIOJVSJDRBLN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|