C19H24F2N2O2 — CID 108959420
N-[2-(cyclohexen-1-yl)ethyl]-N'-(2,4-difluorophenyl)-2,2-dimethylpropanediamide (PubChem CID 108959420) has the molecular formula C19H24F2N2O2 and a molecular weight of 350.41 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N'-(2,4-difluorophenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-(2,4-difluorophenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108959420 |
| Molecular Formula | C19H24F2N2O2 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-(2,4-difluorophenyl)-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)NCCC1=CCCCC1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C19H24F2N2O2/c1-19(2,17(24)22-11-10-13-6-4-3-5-7-13)18(25)23-16-9-8-14(20)12-15(16)21/h6,8-9,12H,3-5,7,10-11H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | KOBYXAOJWBBBAR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|