C20H25FN2O — CID 113210295
N-[2-(cyclohexen-1-yl)ethyl]-2-(6-fluoro-1H-indol-3-yl)-2-methylpropanamide (PubChem CID 113210295) has the molecular formula C20H25FN2O and a molecular weight of 328.43 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(6-fluoro-1H-indol-3-yl)-2-methylpropanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(6-fluoro-1H-indol-3-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 113210295 |
| Molecular Formula | C20H25FN2O |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(6-fluoro-1H-indol-3-yl)-2-methylpropanamide |
| SMILES | CC(C)(C(=O)NCCC1=CCCCC1)c1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C20H25FN2O/c1-20(2,17-13-23-18-12-15(21)8-9-16(17)18)19(24)22-11-10-14-6-4-3-5-7-14/h6,8-9,12-13,23H,3-5,7,10-11H2,1-2H3,(H,22,24) |
| InChIKey | GKHGUPMUUASKPL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|