C18H21FN2O — CID 113209364
N-[2-(cyclohexen-1-yl)ethyl]-2-(6-fluoro-1H-indol-3-yl)acetamide (PubChem CID 113209364) has the molecular formula C18H21FN2O and a molecular weight of 300.38 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(6-fluoro-1H-indol-3-yl)acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(6-fluoro-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 113209364 |
| Molecular Formula | C18H21FN2O |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(6-fluoro-1H-indol-3-yl)acetamide |
| SMILES | O=C(Cc1c[nH]c2cc(F)ccc12)NCCC1=CCCCC1 |
| InChI | InChI=1S/C18H21FN2O/c19-15-6-7-16-14(12-21-17(16)11-15)10-18(22)20-9-8-13-4-2-1-3-5-13/h4,6-7,11-12,21H,1-3,5,8-10H2,(H,20,22) |
| InChIKey | BERNGYKSMPJRGO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|