C18H23FN2O2 — CID 111464495
N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-(1-hydroxycyclohexyl)acetamide (PubChem CID 111464495) has the molecular formula C18H23FN2O2 and a molecular weight of 318.39 g/mol. Its IUPAC name is N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-(1-hydroxycyclohexyl)acetamide.
| Compound Name | N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-(1-hydroxycyclohexyl)acetamide |
|---|---|
| PubChem CID | 111464495 |
| Molecular Formula | C18H23FN2O2 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-(1-hydroxycyclohexyl)acetamide |
| SMILES | O=C(CC1(O)CCCCC1)NCCc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C18H23FN2O2/c19-14-4-5-15-13(12-21-16(15)10-14)6-9-20-17(22)11-18(23)7-2-1-3-8-18/h4-5,10,12,21,23H,1-3,6-9,11H2,(H,20,22) |
| InChIKey | LEWDSLXUIZAXCE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |