C18H16BrFN2O — CID 113083740
2-(3-bromophenyl)-N-[2-(6-fluoro-1H-indol-3-yl)ethyl]acetamide (PubChem CID 113083740) has the molecular formula C18H16BrFN2O and a molecular weight of 375.24 g/mol. Its IUPAC name is 2-(3-bromophenyl)-N-[2-(6-fluoro-1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-(3-bromophenyl)-N-[2-(6-fluoro-1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 113083740 |
| Molecular Formula | C18H16BrFN2O |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 2-(3-bromophenyl)-N-[2-(6-fluoro-1H-indol-3-yl)ethyl]acetamide |
| SMILES | O=C(Cc1cccc(Br)c1)NCCc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C18H16BrFN2O/c19-14-3-1-2-12(8-14)9-18(23)21-7-6-13-11-22-17-10-15(20)4-5-16(13)17/h1-5,8,10-11,22H,6-7,9H2,(H,21,23) |
| InChIKey | BOYGRJVUGZYSMZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |