C22H19FN4O3 — CID 60607228
N-[2-[2-(6-fluoro-1H-indol-3-yl)ethylamino]-2-oxoethyl]-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 60607228) has the molecular formula C22H19FN4O3 and a molecular weight of 406.42 g/mol. Its IUPAC name is N-[2-[2-(6-fluoro-1H-indol-3-yl)ethylamino]-2-oxoethyl]-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[2-[2-(6-fluoro-1H-indol-3-yl)ethylamino]-2-oxoethyl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 60607228 |
| Molecular Formula | C22H19FN4O3 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-[2-[2-(6-fluoro-1H-indol-3-yl)ethylamino]-2-oxoethyl]-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | O=C(CNC(=O)c1c[nH]c2ccccc2c1=O)NCCc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C22H19FN4O3/c23-14-5-6-15-13(10-25-19(15)9-14)7-8-24-20(28)12-27-22(30)17-11-26-18-4-2-1-3-16(18)21(17)29/h1-6,9-11,25H,7-8,12H2,(H,24,28)(H,26,29)(H,27,30) |
| InChIKey | WQZRTVMGPXAWGF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |