C18H17F2N3O — CID 109002509
2-(2,4-difluoroanilino)-N-[2-(1H-indol-3-yl)ethyl]acetamide (PubChem CID 109002509) has the molecular formula C18H17F2N3O and a molecular weight of 329.35 g/mol. Its IUPAC name is 2-(2,4-difluoroanilino)-N-[2-(1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-(2,4-difluoroanilino)-N-[2-(1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 109002509 |
| Molecular Formula | C18H17F2N3O |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-(2,4-difluoroanilino)-N-[2-(1H-indol-3-yl)ethyl]acetamide |
| SMILES | O=C(CNc1ccc(F)cc1F)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H17F2N3O/c19-13-5-6-17(15(20)9-13)23-11-18(24)21-8-7-12-10-22-16-4-2-1-3-14(12)16/h1-6,9-10,22-23H,7-8,11H2,(H,21,24) |
| InChIKey | TZTRZTDXFZKFRD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |