C14H18N4O2 — CID 61258221
2-amino-N-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]acetamide (PubChem CID 61258221) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-amino-N-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]acetamide.
| Compound Name | 2-amino-N-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 61258221 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-amino-N-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]acetamide |
| SMILES | NCC(=O)NCC(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H18N4O2/c15-7-13(19)18-9-14(20)16-6-5-10-8-17-12-4-2-1-3-11(10)12/h1-4,8,17H,5-7,9,15H2,(H,16,20)(H,18,19) |
| InChIKey | SIXMMOYHOQFNSV-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |