C14H19N3OS — CID 84553422
2-(2-aminoethylsulfanyl)-N-[2-(1H-indol-3-yl)ethyl]acetamide (PubChem CID 84553422) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-(2-aminoethylsulfanyl)-N-[2-(1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-(2-aminoethylsulfanyl)-N-[2-(1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 84553422 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-(2-aminoethylsulfanyl)-N-[2-(1H-indol-3-yl)ethyl]acetamide |
| SMILES | NCCSCC(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H19N3OS/c15-6-8-19-10-14(18)16-7-5-11-9-17-13-4-2-1-3-12(11)13/h1-4,9,17H,5-8,10,15H2,(H,16,18) |
| InChIKey | XOEIFOLOKDBFCR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|