C12H13N2O4S2- — CID 3348198
3-[2-[(2-sulfonatosulfanylacetyl)amino]ethyl]-1H-indole (PubChem CID 3348198) has the molecular formula C12H13N2O4S2- and a molecular weight of 313.38 g/mol. Its IUPAC name is 3-[2-[(2-sulfonatosulfanylacetyl)amino]ethyl]-1H-indole.
| Compound Name | 3-[2-[(2-sulfonatosulfanylacetyl)amino]ethyl]-1H-indole |
|---|---|
| PubChem CID | 3348198 |
| Molecular Formula | C12H13N2O4S2- |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 3-[2-[(2-sulfonatosulfanylacetyl)amino]ethyl]-1H-indole |
| SMILES | O=C(CSS(=O)(=O)[O-])NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H14N2O4S2/c15-12(8-19-20(16,17)18)13-6-5-9-7-14-11-4-2-1-3-10(9)11/h1-4,7,14H,5-6,8H2,(H,13,15)(H,16,17,18)/p-1 |
| InChIKey | FHFNZIWTVQLHTO-UHFFFAOYSA-M |
| XLogP | 1.02 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|