C13H15N2O5S2- — CID 3137667
3-[2-(2-sulfonatosulfanylethoxycarbonylamino)ethyl]-1H-indole (PubChem CID 3137667) has the molecular formula C13H15N2O5S2- and a molecular weight of 343.41 g/mol. Its IUPAC name is 3-[2-(2-sulfonatosulfanylethoxycarbonylamino)ethyl]-1H-indole.
| Compound Name | 3-[2-(2-sulfonatosulfanylethoxycarbonylamino)ethyl]-1H-indole |
|---|---|
| PubChem CID | 3137667 |
| Molecular Formula | C13H15N2O5S2- |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 3-[2-(2-sulfonatosulfanylethoxycarbonylamino)ethyl]-1H-indole |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)OCCSS(=O)(=O)[O-] |
| InChI | InChI=1S/C13H16N2O5S2/c16-13(20-7-8-21-22(17,18)19)14-6-5-10-9-15-12-4-2-1-3-11(10)12/h1-4,9,15H,5-8H2,(H,14,16)(H,17,18,19)/p-1 |
| InChIKey | XFENHISFALICPX-UHFFFAOYSA-M |
| XLogP | 1.63 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|