C14H17N2NaO5S2 — CID 23704768
sodium 5-methoxy-3-[2-(3-sulfonatosulfanylpropanoylamino)ethyl]-1H-indole (PubChem CID 23704768) has the molecular formula C14H17N2NaO5S2 and a molecular weight of 380.42 g/mol. Its IUPAC name is sodium 5-methoxy-3-[2-(3-sulfonatosulfanylpropanoylamino)ethyl]-1H-indole.
| Compound Name | sodium 5-methoxy-3-[2-(3-sulfonatosulfanylpropanoylamino)ethyl]-1H-indole |
|---|---|
| PubChem CID | 23704768 |
| Molecular Formula | C14H17N2NaO5S2 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | sodium 5-methoxy-3-[2-(3-sulfonatosulfanylpropanoylamino)ethyl]-1H-indole |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)CCSS(=O)(=O)[O-])c2c1.[Na+] |
| InChI | InChI=1S/C14H18N2O5S2.Na/c1-21-11-2-3-13-12(8-11)10(9-16-13)4-6-15-14(17)5-7-22-23(18,19)20;/h2-3,8-9,16H,4-7H2,1H3,(H,15,17)(H,18,19,20);/q;+1/p-1 |
| InChIKey | AYHPKMTVRIIDCW-UHFFFAOYSA-M |
| XLogP | -1.58 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|