C19H25N3O8-2 — CID 23619192
4-amino-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]butanamide;2,3-dihydroxybutanedioate (PubChem CID 23619192) has the molecular formula C19H25N3O8-2 and a molecular weight of 423.42 g/mol. Its IUPAC name is 4-amino-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]butanamide;2,3-dihydroxybutanedioate.
| Compound Name | 4-amino-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]butanamide;2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 23619192 |
| Molecular Formula | C19H25N3O8-2 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 4-amino-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]butanamide;2,3-dihydroxybutanedioate |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)CCCN)c2c1.O=C([O-])C(O)C(O)C(=O)[O-] |
| InChI | InChI=1S/C15H21N3O2.C4H6O6/c1-20-12-4-5-14-13(9-12)11(10-18-14)6-8-17-15(19)3-2-7-16;5-1(3(7)8)2(6)4(9)10/h4-5,9-10,18H,2-3,6-8,16H2,1H3,(H,17,19);1-2,5-6H,(H,7,8)(H,9,10)/p-2 |
| InChIKey | JVUPDCXTMKIQIJ-UHFFFAOYSA-L |
| XLogP | -3.22 |
| TPSA | 200.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |