C15H21N3O3S — CID 110343313
3-(dimethylsulfamoyl)-N-[2-(1H-indol-3-yl)ethyl]propanamide (PubChem CID 110343313) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-[2-(1H-indol-3-yl)ethyl]propanamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-[2-(1H-indol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 110343313 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-[2-(1H-indol-3-yl)ethyl]propanamide |
| SMILES | CN(C)S(=O)(=O)CCC(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H21N3O3S/c1-18(2)22(20,21)10-8-15(19)16-9-7-12-11-17-14-6-4-3-5-13(12)14/h3-6,11,17H,7-10H2,1-2H3,(H,16,19) |
| InChIKey | KGXSBQXRAZNRKS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |