C21H24FN3O3S — CID 27645506
4-[(4-fluorophenyl)sulfonyl-methylamino]-N-[2-(1H-indol-3-yl)ethyl]butanamide (PubChem CID 27645506) has the molecular formula C21H24FN3O3S and a molecular weight of 417.51 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)sulfonyl-methylamino]-N-[2-(1H-indol-3-yl)ethyl]butanamide.
| Compound Name | 4-[(4-fluorophenyl)sulfonyl-methylamino]-N-[2-(1H-indol-3-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 27645506 |
| Molecular Formula | C21H24FN3O3S |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-[(4-fluorophenyl)sulfonyl-methylamino]-N-[2-(1H-indol-3-yl)ethyl]butanamide |
| SMILES | CN(CCCC(=O)NCCc1c[nH]c2ccccc12)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H24FN3O3S/c1-25(29(27,28)18-10-8-17(22)9-11-18)14-4-7-21(26)23-13-12-16-15-24-20-6-3-2-5-19(16)20/h2-3,5-6,8-11,15,24H,4,7,12-14H2,1H3,(H,23,26) |
| InChIKey | PEUKWBVJDZUTRG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |