C14H23ClFN3O3S — CID 119405561
N-(3-aminopropyl)-4-[(4-fluorophenyl)sulfonyl-methylamino]butanamide;hydrochloride (PubChem CID 119405561) has the molecular formula C14H23ClFN3O3S and a molecular weight of 367.87 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-[(4-fluorophenyl)sulfonyl-methylamino]butanamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-4-[(4-fluorophenyl)sulfonyl-methylamino]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119405561 |
| Molecular Formula | C14H23ClFN3O3S |
| Molecular Weight | 367.87 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-(3-aminopropyl)-4-[(4-fluorophenyl)sulfonyl-methylamino]butanamide;hydrochloride |
| SMILES | CN(CCCC(=O)NCCCN)S(=O)(=O)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C14H22FN3O3S.ClH/c1-18(11-2-4-14(19)17-10-3-9-16)22(20,21)13-7-5-12(15)6-8-13;/h5-8H,2-4,9-11,16H2,1H3,(H,17,19);1H |
| InChIKey | SQJARCATJRRWHE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.87 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|