C15H21FN2O5S2 — CID 119241419
2-[2-[4-[(4-fluorophenyl)sulfonyl-methylamino]butanoylamino]ethylsulfanyl]acetic acid (PubChem CID 119241419) has the molecular formula C15H21FN2O5S2 and a molecular weight of 392.47 g/mol. Its IUPAC name is 2-[2-[4-[(4-fluorophenyl)sulfonyl-methylamino]butanoylamino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[4-[(4-fluorophenyl)sulfonyl-methylamino]butanoylamino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119241419 |
| Molecular Formula | C15H21FN2O5S2 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 2-[2-[4-[(4-fluorophenyl)sulfonyl-methylamino]butanoylamino]ethylsulfanyl]acetic acid |
| SMILES | CN(CCCC(=O)NCCSCC(=O)O)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H21FN2O5S2/c1-18(25(22,23)13-6-4-12(16)5-7-13)9-2-3-14(19)17-8-10-24-11-15(20)21/h4-7H,2-3,8-11H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | QMQDXDOXJRLBLS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|