C15H20N2O6S — CID 119349970
2-[4-[(4-acetylphenyl)sulfonyl-methylamino]butanoylamino]acetic acid (PubChem CID 119349970) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is 2-[4-[(4-acetylphenyl)sulfonyl-methylamino]butanoylamino]acetic acid.
| Compound Name | 2-[4-[(4-acetylphenyl)sulfonyl-methylamino]butanoylamino]acetic acid |
|---|---|
| PubChem CID | 119349970 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-[4-[(4-acetylphenyl)sulfonyl-methylamino]butanoylamino]acetic acid |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N(C)CCCC(=O)NCC(=O)O)cc1 |
| InChI | InChI=1S/C15H20N2O6S/c1-11(18)12-5-7-13(8-6-12)24(22,23)17(2)9-3-4-14(19)16-10-15(20)21/h5-8H,3-4,9-10H2,1-2H3,(H,16,19)(H,20,21) |
| InChIKey | MZLRIURSKWUDJH-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |