C17H27N3O4S — CID 119629209
4-[(4-acetylphenyl)sulfonyl-methylamino]-N-(2-amino-2-methylpropyl)butanamide (PubChem CID 119629209) has the molecular formula C17H27N3O4S and a molecular weight of 369.49 g/mol. Its IUPAC name is 4-[(4-acetylphenyl)sulfonyl-methylamino]-N-(2-amino-2-methylpropyl)butanamide.
| Compound Name | 4-[(4-acetylphenyl)sulfonyl-methylamino]-N-(2-amino-2-methylpropyl)butanamide |
|---|---|
| PubChem CID | 119629209 |
| Molecular Formula | C17H27N3O4S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 4-[(4-acetylphenyl)sulfonyl-methylamino]-N-(2-amino-2-methylpropyl)butanamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N(C)CCCC(=O)NCC(C)(C)N)cc1 |
| InChI | InChI=1S/C17H27N3O4S/c1-13(21)14-7-9-15(10-8-14)25(23,24)20(4)11-5-6-16(22)19-12-17(2,3)18/h7-10H,5-6,11-12,18H2,1-4H3,(H,19,22) |
| InChIKey | SXEHGMFQQHPTIT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |