C20H25N3O4S — CID 18121131
4-acetyl-N-methyl-N-[4-(2-methyl-2-phenylhydrazinyl)-4-oxobutyl]benzenesulfonamide (PubChem CID 18121131) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is 4-acetyl-N-methyl-N-[4-(2-methyl-2-phenylhydrazinyl)-4-oxobutyl]benzenesulfonamide.
| Compound Name | 4-acetyl-N-methyl-N-[4-(2-methyl-2-phenylhydrazinyl)-4-oxobutyl]benzenesulfonamide |
|---|---|
| PubChem CID | 18121131 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 4-acetyl-N-methyl-N-[4-(2-methyl-2-phenylhydrazinyl)-4-oxobutyl]benzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N(C)CCCC(=O)NN(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H25N3O4S/c1-16(24)17-11-13-19(14-12-17)28(26,27)22(2)15-7-10-20(25)21-23(3)18-8-5-4-6-9-18/h4-6,8-9,11-14H,7,10,15H2,1-3H3,(H,21,25) |
| InChIKey | ARRLOJGICRPEJY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|