C23H30N2O4S — CID 18206824
4-[(4-acetylphenyl)sulfonyl-methylamino]-N-(1-phenylbutyl)butanamide (PubChem CID 18206824) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is 4-[(4-acetylphenyl)sulfonyl-methylamino]-N-(1-phenylbutyl)butanamide.
| Compound Name | 4-[(4-acetylphenyl)sulfonyl-methylamino]-N-(1-phenylbutyl)butanamide |
|---|---|
| PubChem CID | 18206824 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 4-[(4-acetylphenyl)sulfonyl-methylamino]-N-(1-phenylbutyl)butanamide |
| SMILES | CCCC(NC(=O)CCCN(C)S(=O)(=O)c1ccc(C(C)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O4S/c1-4-9-22(20-10-6-5-7-11-20)24-23(27)12-8-17-25(3)30(28,29)21-15-13-19(14-16-21)18(2)26/h5-7,10-11,13-16,22H,4,8-9,12,17H2,1-3H3,(H,24,27) |
| InChIKey | SUIMHBFZNCKECQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |