C13H16N2O6S — CID 120602769
2-[3-[(4-acetylphenyl)sulfonylamino]propanoylamino]acetic acid (PubChem CID 120602769) has the molecular formula C13H16N2O6S and a molecular weight of 328.35 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)sulfonylamino]propanoylamino]acetic acid.
| Compound Name | 2-[3-[(4-acetylphenyl)sulfonylamino]propanoylamino]acetic acid |
|---|---|
| PubChem CID | 120602769 |
| Molecular Formula | C13H16N2O6S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)sulfonylamino]propanoylamino]acetic acid |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NCCC(=O)NCC(=O)O)cc1 |
| InChI | InChI=1S/C13H16N2O6S/c1-9(16)10-2-4-11(5-3-10)22(20,21)15-7-6-12(17)14-8-13(18)19/h2-5,15H,6-8H2,1H3,(H,14,17)(H,18,19) |
| InChIKey | IBKRZUSTCOWPPR-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |