C12H15NO6S — CID 104934017
(2S)-4-[(4-acetylphenyl)sulfonylamino]-2-hydroxybutanoic acid (PubChem CID 104934017) has the molecular formula C12H15NO6S and a molecular weight of 301.32 g/mol. Its IUPAC name is (2S)-4-[(4-acetylphenyl)sulfonylamino]-2-hydroxybutanoic acid.
| Compound Name | (2S)-4-[(4-acetylphenyl)sulfonylamino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104934017 |
| Molecular Formula | C12H15NO6S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | (2S)-4-[(4-acetylphenyl)sulfonylamino]-2-hydroxybutanoic acid |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NCC[C@H](O)C(=O)O)cc1 |
| InChI | InChI=1S/C12H15NO6S/c1-8(14)9-2-4-10(5-3-9)20(18,19)13-7-6-11(15)12(16)17/h2-5,11,13,15H,6-7H2,1H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | BXEVEHQIWVNWRP-NSHDSACASA-N |
| XLogP | 0.00 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |