C15H23NO4S — CID 90523493
4-acetyl-N-(3-hydroxy-4,4-dimethylpentyl)benzenesulfonamide (PubChem CID 90523493) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is 4-acetyl-N-(3-hydroxy-4,4-dimethylpentyl)benzenesulfonamide.
| Compound Name | 4-acetyl-N-(3-hydroxy-4,4-dimethylpentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90523493 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 4-acetyl-N-(3-hydroxy-4,4-dimethylpentyl)benzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NCCC(O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H23NO4S/c1-11(17)12-5-7-13(8-6-12)21(19,20)16-10-9-14(18)15(2,3)4/h5-8,14,16,18H,9-10H2,1-4H3 |
| InChIKey | GCWKUYBPFDIYRW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |