C13H20ClNO3S — CID 90523486
2-chloro-N-(3-hydroxy-4,4-dimethylpentyl)benzenesulfonamide (PubChem CID 90523486) has the molecular formula C13H20ClNO3S and a molecular weight of 305.83 g/mol. Its IUPAC name is 2-chloro-N-(3-hydroxy-4,4-dimethylpentyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-(3-hydroxy-4,4-dimethylpentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90523486 |
| Molecular Formula | C13H20ClNO3S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-chloro-N-(3-hydroxy-4,4-dimethylpentyl)benzenesulfonamide |
| SMILES | CC(C)(C)C(O)CCNS(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C13H20ClNO3S/c1-13(2,3)12(16)8-9-15-19(17,18)11-7-5-4-6-10(11)14/h4-7,12,15-16H,8-9H2,1-3H3 |
| InChIKey | IGVZPLHCFJNZOH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |