C10H14ClNO3S — CID 96832456
2-chloro-N-[(2S)-3-hydroxy-2-methylpropyl]benzenesulfonamide (PubChem CID 96832456) has the molecular formula C10H14ClNO3S and a molecular weight of 263.75 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-3-hydroxy-2-methylpropyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[(2S)-3-hydroxy-2-methylpropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 96832456 |
| Molecular Formula | C10H14ClNO3S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2-chloro-N-[(2S)-3-hydroxy-2-methylpropyl]benzenesulfonamide |
| SMILES | C[C@H](CO)CNS(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C10H14ClNO3S/c1-8(7-13)6-12-16(14,15)10-5-3-2-4-9(10)11/h2-5,8,12-13H,6-7H2,1H3/t8-/m0/s1 |
| InChIKey | KVELCIBHGAWPIV-QMMMGPOBSA-N |
| XLogP | 1.25 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |